C22H17NO7 — CID 11269779
dimethyl (2R,5R)-2-(furan-2-yl)-2'-oxo-1'-prop-2-ynylspiro[2H-furan-5,3'-indole]-3,4-dicarboxylate (PubChem CID 11269779) has the molecular formula C22H17NO7 and a molecular weight of 407.38 g/mol. Its IUPAC name is dimethyl (2R,5R)-2-(furan-2-yl)-2'-oxo-1'-prop-2-ynylspiro[2H-furan-5,3'-indole]-3,4-dicarboxylate.
| Compound Name | dimethyl (2R,5R)-2-(furan-2-yl)-2'-oxo-1'-prop-2-ynylspiro[2H-furan-5,3'-indole]-3,4-dicarboxylate |
|---|---|
| PubChem CID | 11269779 |
| Molecular Formula | C22H17NO7 |
| Molecular Weight | 407.38 g/mol |
| Exact Mass | 407.10 |
| IUPAC Name | dimethyl (2R,5R)-2-(furan-2-yl)-2'-oxo-1'-prop-2-ynylspiro[2H-furan-5,3'-indole]-3,4-dicarboxylate |
| SMILES | C#CCN1C(=O)[C@@]2(O[C@@H](c3ccco3)C(C(=O)OC)=C2C(=O)OC)c2ccccc21 |
| InChI | InChI=1S/C22H17NO7/c1-4-11-23-14-9-6-5-8-13(14)22(21(23)26)17(20(25)28-3)16(19(24)27-2)18(30-22)15-10-7-12-29-15/h1,5-10,12,18H,11H2,2-3H3/t18-,22+/m0/s1 |
| InChIKey | LKMNVMPKLVKKSH-PGRDOPGGSA-N |
| XLogP | 1.87 |
| TPSA | 95.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.38 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|