C28H21NO4 — CID 71480243
1-(anthracen-9-ylmethyl)-5-methoxy-2'-methylidenespiro[indole-3,5'-oxolane]-2,3'-dione (PubChem CID 71480243) has the molecular formula C28H21NO4 and a molecular weight of 435.48 g/mol. Its IUPAC name is 1-(anthracen-9-ylmethyl)-5-methoxy-2'-methylidenespiro[indole-3,5'-oxolane]-2,3'-dione.
| Compound Name | 1-(anthracen-9-ylmethyl)-5-methoxy-2'-methylidenespiro[indole-3,5'-oxolane]-2,3'-dione |
|---|---|
| PubChem CID | 71480243 |
| Molecular Formula | C28H21NO4 |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | 1-(anthracen-9-ylmethyl)-5-methoxy-2'-methylidenespiro[indole-3,5'-oxolane]-2,3'-dione |
| SMILES | C=C1OC2(CC1=O)C(=O)N(Cc1c3ccccc3cc3ccccc13)c1ccc(OC)cc12 |
| InChI | InChI=1S/C28H21NO4/c1-17-26(30)15-28(33-17)24-14-20(32-2)11-12-25(24)29(27(28)31)16-23-21-9-5-3-7-18(21)13-19-8-4-6-10-22(19)23/h3-14H,1,15-16H2,2H3 |
| InChIKey | KZNKNSBCJHVCHB-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|