C19H24N2O3 — CID 22769302
2'-(2-morpholin-4-ylethyl)spiro[cyclopentane-1,4'-isoquinoline]-1',3'-dione (PubChem CID 22769302) has the molecular formula C19H24N2O3 and a molecular weight of 328.41 g/mol. Its IUPAC name is 2'-(2-morpholin-4-ylethyl)spiro[cyclopentane-1,4'-isoquinoline]-1',3'-dione.
| Compound Name | 2'-(2-morpholin-4-ylethyl)spiro[cyclopentane-1,4'-isoquinoline]-1',3'-dione |
|---|---|
| PubChem CID | 22769302 |
| Molecular Formula | C19H24N2O3 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | 2'-(2-morpholin-4-ylethyl)spiro[cyclopentane-1,4'-isoquinoline]-1',3'-dione |
| SMILES | O=C1c2ccccc2C2(CCCC2)C(=O)N1CCN1CCOCC1 |
| InChI | InChI=1S/C19H24N2O3/c22-17-15-5-1-2-6-16(15)19(7-3-4-8-19)18(23)21(17)10-9-20-11-13-24-14-12-20/h1-2,5-6H,3-4,7-14H2 |
| InChIKey | WMWODGNHFONVAF-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|