C24H24BrNO5 — CID 57398745
(2E,6E)-2-[(3-bromo-5-methoxy-4-propoxyphenyl)methylidene]-6-[(3-nitrophenyl)methylidene]cyclohexan-1-one (PubChem CID 57398745) has the molecular formula C24H24BrNO5 and a molecular weight of 486.36 g/mol. Its IUPAC name is (2E,6E)-2-[(3-bromo-5-methoxy-4-propoxyphenyl)methylidene]-6-[(3-nitrophenyl)methylidene]cyclohexan-1-one.
| Compound Name | (2E,6E)-2-[(3-bromo-5-methoxy-4-propoxyphenyl)methylidene]-6-[(3-nitrophenyl)methylidene]cyclohexan-1-one |
|---|---|
| PubChem CID | 57398745 |
| Molecular Formula | C24H24BrNO5 |
| Molecular Weight | 486.36 g/mol |
| Exact Mass | 485.08 |
| IUPAC Name | (2E,6E)-2-[(3-bromo-5-methoxy-4-propoxyphenyl)methylidene]-6-[(3-nitrophenyl)methylidene]cyclohexan-1-one |
| SMILES | CCCOc1c(Br)cc(/C=C2\CCC/C(=C\c3cccc([N+](=O)[O-])c3)C2=O)cc1OC |
| InChI | InChI=1S/C24H24BrNO5/c1-3-10-31-24-21(25)14-17(15-22(24)30-2)12-19-8-5-7-18(23(19)27)11-16-6-4-9-20(13-16)26(28)29/h4,6,9,11-15H,3,5,7-8,10H2,1-2H3/b18-11+,19-12+ |
| InChIKey | SFDNWMCKFNAYET-GDAWTGGTSA-N |
| XLogP | 6.37 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.36 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|