C17H20N2O3 — CID 82022973
4-[(6E)-6-[(3-nitrophenyl)methylidene]cyclohexen-1-yl]morpholine (PubChem CID 82022973) has the molecular formula C17H20N2O3 and a molecular weight of 300.36 g/mol. Its IUPAC name is 4-[(6E)-6-[(3-nitrophenyl)methylidene]cyclohexen-1-yl]morpholine.
| Compound Name | 4-[(6E)-6-[(3-nitrophenyl)methylidene]cyclohexen-1-yl]morpholine |
|---|---|
| PubChem CID | 82022973 |
| Molecular Formula | C17H20N2O3 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | 4-[(6E)-6-[(3-nitrophenyl)methylidene]cyclohexen-1-yl]morpholine |
| SMILES | O=[N+]([O-])c1cccc(/C=C2\CCCC=C2N2CCOCC2)c1 |
| InChI | InChI=1S/C17H20N2O3/c20-19(21)16-6-3-4-14(13-16)12-15-5-1-2-7-17(15)18-8-10-22-11-9-18/h3-4,6-7,12-13H,1-2,5,8-11H2/b15-12+ |
| InChIKey | GLPSPNIYPXWRDE-NTCAYCPXSA-N |
| XLogP | 3.38 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|