C25H22N6O6 — CID 136747958
(3Z)-3-[(Z)-[(3E)-2-morpholin-4-yl-3-[(3-nitrophenyl)methylidene]cyclopenten-1-yl]methylidenehydrazinylidene]-5-nitro-1H-indol-2-one (PubChem CID 136747958) has the molecular formula C25H22N6O6 and a molecular weight of 502.49 g/mol. Its IUPAC name is (3Z)-3-[(Z)-[(3E)-2-morpholin-4-yl-3-[(3-nitrophenyl)methylidene]cyclopenten-1-yl]methylidenehydrazinylidene]-5-nitro-1H-indol-2-one.
| Compound Name | (3Z)-3-[(Z)-[(3E)-2-morpholin-4-yl-3-[(3-nitrophenyl)methylidene]cyclopenten-1-yl]methylidenehydrazinylidene]-5-nitro-1H-indol-2-one |
|---|---|
| PubChem CID | 136747958 |
| Molecular Formula | C25H22N6O6 |
| Molecular Weight | 502.49 g/mol |
| Exact Mass | 502.16 |
| IUPAC Name | (3Z)-3-[(Z)-[(3E)-2-morpholin-4-yl-3-[(3-nitrophenyl)methylidene]cyclopenten-1-yl]methylidenehydrazinylidene]-5-nitro-1H-indol-2-one |
| SMILES | O=C1Nc2ccc([N+](=O)[O-])cc2/C1=N/N=C\C1=C(N2CCOCC2)/C(=C/c2cccc([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C25H22N6O6/c32-25-23(21-14-20(31(35)36)6-7-22(21)27-25)28-26-15-18-5-4-17(24(18)29-8-10-37-11-9-29)12-16-2-1-3-19(13-16)30(33)34/h1-3,6-7,12-15H,4-5,8-11H2,(H,27,28,32)/b17-12+,26-15- |
| InChIKey | FDUFWGOURFNDIM-IQDFEJNRSA-N |
| XLogP | 3.69 |
| TPSA | 152.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.49 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_one_isatin(189)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|