C26H22N4O3S — CID 4641722
2-(1,3-benzothiazol-2-yl)-3-[2-morpholin-4-yl-3-[(3-nitrophenyl)methylidene]cyclopenten-1-yl]prop-2-enenitrile (PubChem CID 4641722) has the molecular formula C26H22N4O3S and a molecular weight of 470.55 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)-3-[2-morpholin-4-yl-3-[(3-nitrophenyl)methylidene]cyclopenten-1-yl]prop-2-enenitrile.
| Compound Name | 2-(1,3-benzothiazol-2-yl)-3-[2-morpholin-4-yl-3-[(3-nitrophenyl)methylidene]cyclopenten-1-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 4641722 |
| Molecular Formula | C26H22N4O3S |
| Molecular Weight | 470.55 g/mol |
| Exact Mass | 470.14 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yl)-3-[2-morpholin-4-yl-3-[(3-nitrophenyl)methylidene]cyclopenten-1-yl]prop-2-enenitrile |
| SMILES | N#CC(=CC1=C(N2CCOCC2)C(=Cc2cccc([N+](=O)[O-])c2)CC1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C26H22N4O3S/c27-17-21(26-28-23-6-1-2-7-24(23)34-26)16-20-9-8-19(25(20)29-10-12-33-13-11-29)14-18-4-3-5-22(15-18)30(31)32/h1-7,14-16H,8-13H2 |
| InChIKey | ZABSYIPSRRDTNB-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 92.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.55 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|