C27H23F3N4O4 — CID 84583086
2-cyano-3-[(3Z)-2-morpholin-4-yl-3-[(4-nitrophenyl)methylidene]cyclopenten-1-yl]-N-[3-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 84583086) has the molecular formula C27H23F3N4O4 and a molecular weight of 524.50 g/mol. Its IUPAC name is 2-cyano-3-[(3Z)-2-morpholin-4-yl-3-[(4-nitrophenyl)methylidene]cyclopenten-1-yl]-N-[3-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | 2-cyano-3-[(3Z)-2-morpholin-4-yl-3-[(4-nitrophenyl)methylidene]cyclopenten-1-yl]-N-[3-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 84583086 |
| Molecular Formula | C27H23F3N4O4 |
| Molecular Weight | 524.50 g/mol |
| Exact Mass | 524.17 |
| IUPAC Name | 2-cyano-3-[(3Z)-2-morpholin-4-yl-3-[(4-nitrophenyl)methylidene]cyclopenten-1-yl]-N-[3-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | N#CC(=CC1=C(N2CCOCC2)/C(=C\c2ccc([N+](=O)[O-])cc2)CC1)C(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C27H23F3N4O4/c28-27(29,30)22-2-1-3-23(16-22)32-26(35)21(17-31)15-20-7-6-19(25(20)33-10-12-38-13-11-33)14-18-4-8-24(9-5-18)34(36)37/h1-5,8-9,14-16H,6-7,10-13H2,(H,32,35)/b19-14-,21-15? |
| InChIKey | FVABYXDNFGEKKN-VOTCJDSBSA-N |
| XLogP | 5.47 |
| TPSA | 108.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.50 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|