C26H23ClFN3O2 — CID 2338330
(E)-3-[(3E)-3-[(4-chlorophenyl)methylidene]-2-morpholin-4-ylcyclopenten-1-yl]-2-cyano-N-(2-fluorophenyl)prop-2-enamide (PubChem CID 2338330) has the molecular formula C26H23ClFN3O2 and a molecular weight of 463.94 g/mol. Its IUPAC name is (E)-3-[(3E)-3-[(4-chlorophenyl)methylidene]-2-morpholin-4-ylcyclopenten-1-yl]-2-cyano-N-(2-fluorophenyl)prop-2-enamide.
| Compound Name | (E)-3-[(3E)-3-[(4-chlorophenyl)methylidene]-2-morpholin-4-ylcyclopenten-1-yl]-2-cyano-N-(2-fluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 2338330 |
| Molecular Formula | C26H23ClFN3O2 |
| Molecular Weight | 463.94 g/mol |
| Exact Mass | 463.15 |
| IUPAC Name | (E)-3-[(3E)-3-[(4-chlorophenyl)methylidene]-2-morpholin-4-ylcyclopenten-1-yl]-2-cyano-N-(2-fluorophenyl)prop-2-enamide |
| SMILES | N#C/C(=C\C1=C(N2CCOCC2)/C(=C/c2ccc(Cl)cc2)CC1)C(=O)Nc1ccccc1F |
| InChI | InChI=1S/C26H23ClFN3O2/c27-22-9-5-18(6-10-22)15-19-7-8-20(25(19)31-11-13-33-14-12-31)16-21(17-29)26(32)30-24-4-2-1-3-23(24)28/h1-6,9-10,15-16H,7-8,11-14H2,(H,30,32)/b19-15+,21-16+ |
| InChIKey | WYIWEKXQKQANMX-WIDTVHIISA-N |
| XLogP | 5.33 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.94 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|