C27H24F2N4O4S — CID 3582045
2-cyano-N-[4-(difluoromethylsulfanyl)phenyl]-3-[2-morpholin-4-yl-3-[(3-nitrophenyl)methylidene]cyclopenten-1-yl]prop-2-enamide (PubChem CID 3582045) has the molecular formula C27H24F2N4O4S and a molecular weight of 538.58 g/mol. Its IUPAC name is 2-cyano-N-[4-(difluoromethylsulfanyl)phenyl]-3-[2-morpholin-4-yl-3-[(3-nitrophenyl)methylidene]cyclopenten-1-yl]prop-2-enamide.
| Compound Name | 2-cyano-N-[4-(difluoromethylsulfanyl)phenyl]-3-[2-morpholin-4-yl-3-[(3-nitrophenyl)methylidene]cyclopenten-1-yl]prop-2-enamide |
|---|---|
| PubChem CID | 3582045 |
| Molecular Formula | C27H24F2N4O4S |
| Molecular Weight | 538.58 g/mol |
| Exact Mass | 538.15 |
| IUPAC Name | 2-cyano-N-[4-(difluoromethylsulfanyl)phenyl]-3-[2-morpholin-4-yl-3-[(3-nitrophenyl)methylidene]cyclopenten-1-yl]prop-2-enamide |
| SMILES | N#CC(=CC1=C(N2CCOCC2)C(=Cc2cccc([N+](=O)[O-])c2)CC1)C(=O)Nc1ccc(SC(F)F)cc1 |
| InChI | InChI=1S/C27H24F2N4O4S/c28-27(29)38-24-8-6-22(7-9-24)31-26(34)21(17-30)16-20-5-4-19(25(20)32-10-12-37-13-11-32)14-18-2-1-3-23(15-18)33(35)36/h1-3,6-9,14-16,27H,4-5,10-13H2,(H,31,34) |
| InChIKey | OIBIFPYSVPRTDL-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 108.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.58 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|