C20H19ClF3NO2 — CID 2306752
(E)-4-[(3Z)-3-[(4-chlorophenyl)methylidene]-2-morpholin-4-ylcyclopenten-1-yl]-1,1,1-trifluorobut-3-en-2-one (PubChem CID 2306752) has the molecular formula C20H19ClF3NO2 and a molecular weight of 397.82 g/mol. Its IUPAC name is (E)-4-[(3Z)-3-[(4-chlorophenyl)methylidene]-2-morpholin-4-ylcyclopenten-1-yl]-1,1,1-trifluorobut-3-en-2-one.
| Compound Name | (E)-4-[(3Z)-3-[(4-chlorophenyl)methylidene]-2-morpholin-4-ylcyclopenten-1-yl]-1,1,1-trifluorobut-3-en-2-one |
|---|---|
| PubChem CID | 2306752 |
| Molecular Formula | C20H19ClF3NO2 |
| Molecular Weight | 397.82 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | (E)-4-[(3Z)-3-[(4-chlorophenyl)methylidene]-2-morpholin-4-ylcyclopenten-1-yl]-1,1,1-trifluorobut-3-en-2-one |
| SMILES | O=C(/C=C/C1=C(N2CCOCC2)/C(=C\c2ccc(Cl)cc2)CC1)C(F)(F)F |
| InChI | InChI=1S/C20H19ClF3NO2/c21-17-6-1-14(2-7-17)13-16-4-3-15(5-8-18(26)20(22,23)24)19(16)25-9-11-27-12-10-25/h1-2,5-8,13H,3-4,9-12H2/b8-5+,16-13- |
| InChIKey | NQZGODNHKZEWIU-CVAKKSDJSA-N |
| XLogP | 4.79 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.82 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|