C17H9ClF3N3O4 — CID 126235267
(Z)-3-(5-chloro-2-hydroxy-3-nitrophenyl)-2-cyano-N-[3-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 126235267) has the molecular formula C17H9ClF3N3O4 and a molecular weight of 411.72 g/mol. Its IUPAC name is (Z)-3-(5-chloro-2-hydroxy-3-nitrophenyl)-2-cyano-N-[3-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | (Z)-3-(5-chloro-2-hydroxy-3-nitrophenyl)-2-cyano-N-[3-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 126235267 |
| Molecular Formula | C17H9ClF3N3O4 |
| Molecular Weight | 411.72 g/mol |
| Exact Mass | 411.02 |
| IUPAC Name | (Z)-3-(5-chloro-2-hydroxy-3-nitrophenyl)-2-cyano-N-[3-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | N#C/C(=C/c1cc(Cl)cc([N+](=O)[O-])c1O)C(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H9ClF3N3O4/c18-12-5-9(15(25)14(7-12)24(27)28)4-10(8-22)16(26)23-13-3-1-2-11(6-13)17(19,20)21/h1-7,25H,(H,23,26)/b10-4- |
| InChIKey | JJQKRFJDXRVKKN-WMZJFQQLSA-N |
| XLogP | 4.52 |
| TPSA | 116.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.72 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|