C21H19F3N4O — CID 108826405
(Z)-2-cyano-3-(4-phenylpiperazin-1-yl)-N-[3-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 108826405) has the molecular formula C21H19F3N4O and a molecular weight of 400.40 g/mol. Its IUPAC name is (Z)-2-cyano-3-(4-phenylpiperazin-1-yl)-N-[3-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-(4-phenylpiperazin-1-yl)-N-[3-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 108826405 |
| Molecular Formula | C21H19F3N4O |
| Molecular Weight | 400.40 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | (Z)-2-cyano-3-(4-phenylpiperazin-1-yl)-N-[3-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | N#C/C(=C/N1CCN(c2ccccc2)CC1)C(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H19F3N4O/c22-21(23,24)17-5-4-6-18(13-17)26-20(29)16(14-25)15-27-9-11-28(12-10-27)19-7-2-1-3-8-19/h1-8,13,15H,9-12H2,(H,26,29)/b16-15- |
| InChIKey | GCOSKGSHCHJILS-NXVVXOECSA-N |
| XLogP | 3.87 |
| TPSA | 59.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.40 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|