C22H22N4O3 — CID 108823404
4-[[(Z)-2-cyano-3-[4-(3-methylphenyl)piperazin-1-yl]prop-2-enoyl]amino]benzoic acid (PubChem CID 108823404) has the molecular formula C22H22N4O3 and a molecular weight of 390.44 g/mol. Its IUPAC name is 4-[[(Z)-2-cyano-3-[4-(3-methylphenyl)piperazin-1-yl]prop-2-enoyl]amino]benzoic acid.
| Compound Name | 4-[[(Z)-2-cyano-3-[4-(3-methylphenyl)piperazin-1-yl]prop-2-enoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 108823404 |
| Molecular Formula | C22H22N4O3 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | 4-[[(Z)-2-cyano-3-[4-(3-methylphenyl)piperazin-1-yl]prop-2-enoyl]amino]benzoic acid |
| SMILES | Cc1cccc(N2CCN(/C=C(/C#N)C(=O)Nc3ccc(C(=O)O)cc3)CC2)c1 |
| InChI | InChI=1S/C22H22N4O3/c1-16-3-2-4-20(13-16)26-11-9-25(10-12-26)15-18(14-23)21(27)24-19-7-5-17(6-8-19)22(28)29/h2-8,13,15H,9-12H2,1H3,(H,24,27)(H,28,29)/b18-15- |
| InChIKey | CLBUYVQMGCWMNA-SDXDJHTJSA-N |
| XLogP | 2.86 |
| TPSA | 96.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|