C20H19ClN4O2 — CID 108827506
(Z)-3-[4-(3-chlorophenyl)piperazin-1-yl]-2-cyano-N-(4-hydroxyphenyl)prop-2-enamide (PubChem CID 108827506) has the molecular formula C20H19ClN4O2 and a molecular weight of 382.85 g/mol. Its IUPAC name is (Z)-3-[4-(3-chlorophenyl)piperazin-1-yl]-2-cyano-N-(4-hydroxyphenyl)prop-2-enamide.
| Compound Name | (Z)-3-[4-(3-chlorophenyl)piperazin-1-yl]-2-cyano-N-(4-hydroxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 108827506 |
| Molecular Formula | C20H19ClN4O2 |
| Molecular Weight | 382.85 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | (Z)-3-[4-(3-chlorophenyl)piperazin-1-yl]-2-cyano-N-(4-hydroxyphenyl)prop-2-enamide |
| SMILES | N#C/C(=C/N1CCN(c2cccc(Cl)c2)CC1)C(=O)Nc1ccc(O)cc1 |
| InChI | InChI=1S/C20H19ClN4O2/c21-16-2-1-3-18(12-16)25-10-8-24(9-11-25)14-15(13-22)20(27)23-17-4-6-19(26)7-5-17/h1-7,12,14,26H,8-11H2,(H,23,27)/b15-14- |
| InChIKey | YTEQMBIIOKZUBD-PFONDFGASA-N |
| XLogP | 3.21 |
| TPSA | 79.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.85 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|