C11H3Cl5N2O3 — CID 133092130
3-nitro-5-(2,3,4,5,6-pentachlorophenyl)-1H-pyridin-2-one (PubChem CID 133092130) has the molecular formula C11H3Cl5N2O3 and a molecular weight of 388.42 g/mol. Its IUPAC name is 3-nitro-5-(2,3,4,5,6-pentachlorophenyl)-1H-pyridin-2-one.
| Compound Name | 3-nitro-5-(2,3,4,5,6-pentachlorophenyl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 133092130 |
| Molecular Formula | C11H3Cl5N2O3 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 385.86 |
| IUPAC Name | 3-nitro-5-(2,3,4,5,6-pentachlorophenyl)-1H-pyridin-2-one |
| SMILES | O=c1[nH]cc(-c2c(Cl)c(Cl)c(Cl)c(Cl)c2Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H3Cl5N2O3/c12-6-5(7(13)9(15)10(16)8(6)14)3-1-4(18(20)21)11(19)17-2-3/h1-2H,(H,17,19) |
| InChIKey | HQIFLHAFVYRLBG-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 76.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|