C17H3Cl10NO — CID 133092089
3,5-bis(2,3,4,5,6-pentachlorophenyl)-1H-pyridin-2-one (PubChem CID 133092089) has the molecular formula C17H3Cl10NO and a molecular weight of 591.75 g/mol. Its IUPAC name is 3,5-bis(2,3,4,5,6-pentachlorophenyl)-1H-pyridin-2-one.
| Compound Name | 3,5-bis(2,3,4,5,6-pentachlorophenyl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 133092089 |
| Molecular Formula | C17H3Cl10NO |
| Molecular Weight | 591.75 g/mol |
| Exact Mass | 586.71 |
| IUPAC Name | 3,5-bis(2,3,4,5,6-pentachlorophenyl)-1H-pyridin-2-one |
| SMILES | O=c1[nH]cc(-c2c(Cl)c(Cl)c(Cl)c(Cl)c2Cl)cc1-c1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C17H3Cl10NO/c18-7-5(8(19)12(23)15(26)11(7)22)3-1-4(17(29)28-2-3)6-9(20)13(24)16(27)14(25)10(6)21/h1-2H,(H,28,29) |
| InChIKey | HKTXAOXTLFCCAU-UHFFFAOYSA-N |
| XLogP | 10.24 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.75 |
| LogP ≤ 5 | 10.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|