C17H9Cl4NO — CID 133092457
3,5-bis(2,3-dichlorophenyl)-1H-pyridin-2-one (PubChem CID 133092457) has the molecular formula C17H9Cl4NO and a molecular weight of 385.08 g/mol. Its IUPAC name is 3,5-bis(2,3-dichlorophenyl)-1H-pyridin-2-one.
| Compound Name | 3,5-bis(2,3-dichlorophenyl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 133092457 |
| Molecular Formula | C17H9Cl4NO |
| Molecular Weight | 385.08 g/mol |
| Exact Mass | 382.94 |
| IUPAC Name | 3,5-bis(2,3-dichlorophenyl)-1H-pyridin-2-one |
| SMILES | O=c1[nH]cc(-c2cccc(Cl)c2Cl)cc1-c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C17H9Cl4NO/c18-13-5-1-3-10(15(13)20)9-7-12(17(23)22-8-9)11-4-2-6-14(19)16(11)21/h1-8H,(H,22,23) |
| InChIKey | UUSLGONUBZOEAO-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.08 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |