C10H6Cl2N2O — CID 136691812
4-(2,3-dichlorophenyl)-1H-pyrimidin-6-one (PubChem CID 136691812) has the molecular formula C10H6Cl2N2O and a molecular weight of 241.08 g/mol. Its IUPAC name is 4-(2,3-dichlorophenyl)-1H-pyrimidin-6-one.
| Compound Name | 4-(2,3-dichlorophenyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136691812 |
| Molecular Formula | C10H6Cl2N2O |
| Molecular Weight | 241.08 g/mol |
| Exact Mass | 239.99 |
| IUPAC Name | 4-(2,3-dichlorophenyl)-1H-pyrimidin-6-one |
| SMILES | O=c1cc(-c2cccc(Cl)c2Cl)nc[nH]1 |
| InChI | InChI=1S/C10H6Cl2N2O/c11-7-3-1-2-6(10(7)12)8-4-9(15)14-5-13-8/h1-5H,(H,13,14,15) |
| InChIKey | GHJOWLJURBWWON-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.08 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |