C13H12N6O4 — CID 160770499
5-amino-6-oxo-1H-pyridine-3-carbonitrile;methane;5-nitro-6-oxo-1H-pyridine-3-carbonitrile (PubChem CID 160770499) has the molecular formula C13H12N6O4 and a molecular weight of 316.28 g/mol. Its IUPAC name is 5-amino-6-oxo-1H-pyridine-3-carbonitrile;methane;5-nitro-6-oxo-1H-pyridine-3-carbonitrile.
| Compound Name | 5-amino-6-oxo-1H-pyridine-3-carbonitrile;methane;5-nitro-6-oxo-1H-pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 160770499 |
| Molecular Formula | C13H12N6O4 |
| Molecular Weight | 316.28 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | 5-amino-6-oxo-1H-pyridine-3-carbonitrile;methane;5-nitro-6-oxo-1H-pyridine-3-carbonitrile |
| SMILES | C.N#Cc1c[nH]c(=O)c(N)c1.N#Cc1c[nH]c(=O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C6H3N3O3.C6H5N3O.CH4/c7-2-4-1-5(9(11)12)6(10)8-3-4;7-2-4-1-5(8)6(10)9-3-4;/h1,3H,(H,8,10);1,3H,8H2,(H,9,10);1H4 |
| InChIKey | RZGDMDXMLCWVHW-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 182.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.28 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|