About sodium;2-chloro-5-nitro-1H-pyrimidin-6-one;hydrate
sodium;2-chloro-5-nitro-1H-pyrimidin-6-one;hydrate (PubChem CID 23720880) has the molecular formula C4H4ClN3NaO4+
and a molecular weight of 216.54 g/mol. Its IUPAC name is sodium;2-chloro-5-nitro-1H-pyrimidin-6-one;hydrate.
Molecular Properties
| Compound Name | sodium;2-chloro-5-nitro-1H-pyrimidin-6-one;hydrate |
| PubChem CID | 23720880 |
| Molecular Formula | C4H4ClN3NaO4+ |
| Molecular Weight | 216.54 g/mol |
| Exact Mass | 215.98 |
| IUPAC Name | sodium;2-chloro-5-nitro-1H-pyrimidin-6-one;hydrate |
| SMILES | O.O=c1[nH]c(Cl)ncc1[N+](=O)[O-].[Na+] |
| InChI | InChI=1S/C4H2ClN3O3.Na.H2O/c5-4-6-1-2(8(10)11)3(9)7-4;;/h1H,(H,6,7,9);;1H2/q;+1; |
| InChIKey | ZHZAHJPKHMQYDB-UHFFFAOYSA-N |
| XLogP | -3.49 |
| TPSA | 120.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.54 |
| LogP ≤ 5 | -3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze sodium;2-chloro-5-nitro-1H-pyrimidin-6-one;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;2-chloro-5-nitro-1H-pyrimidin-6-one;hydrate?
The IUPAC name of sodium;2-chloro-5-nitro-1H-pyrimidin-6-one;hydrate (CID 23720880) is sodium;2-chloro-5-nitro-1H-pyrimidin-6-one;hydrate.
What is the SMILES notation for sodium;2-chloro-5-nitro-1H-pyrimidin-6-one;hydrate?
The canonical SMILES for sodium;2-chloro-5-nitro-1H-pyrimidin-6-one;hydrate is O.O=c1[nH]c(Cl)ncc1[N+](=O)[O-].[Na+].
What is the InChIKey of sodium;2-chloro-5-nitro-1H-pyrimidin-6-one;hydrate?
The InChIKey is ZHZAHJPKHMQYDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H2ClN3O3.Na.H2O/c5-4-6-1-2(8(10)11)3(9)7-4;;/h1H,(H,6,7,9);;1H2/q;+1;.
What are the key properties of sodium;2-chloro-5-nitro-1H-pyrimidin-6-one;hydrate?
sodium;2-chloro-5-nitro-1H-pyrimidin-6-one;hydrate has a molecular weight of 216.54 g/mol, XLogP of -3.49, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;2-chloro-5-nitro-1H-pyrimidin-6-one;hydrate is sourced from PubChem (CID 23720880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).