C8H5ClN4O4S — CID 79765110
1-[(2-chloro-1,3-thiazol-5-yl)methyl]-5-nitropyrimidine-2,4-dione (PubChem CID 79765110) has the molecular formula C8H5ClN4O4S and a molecular weight of 288.67 g/mol. Its IUPAC name is 1-[(2-chloro-1,3-thiazol-5-yl)methyl]-5-nitropyrimidine-2,4-dione.
| Compound Name | 1-[(2-chloro-1,3-thiazol-5-yl)methyl]-5-nitropyrimidine-2,4-dione |
|---|---|
| PubChem CID | 79765110 |
| Molecular Formula | C8H5ClN4O4S |
| Molecular Weight | 288.67 g/mol |
| Exact Mass | 287.97 |
| IUPAC Name | 1-[(2-chloro-1,3-thiazol-5-yl)methyl]-5-nitropyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n(Cc2cnc(Cl)s2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C8H5ClN4O4S/c9-7-10-1-4(18-7)2-12-3-5(13(16)17)6(14)11-8(12)15/h1,3H,2H2,(H,11,14,15) |
| InChIKey | WFQXDBITHKDYRC-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 110.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.67 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|