C15H20F3N3O3 — CID 133281371
2-[4-[[4-nitro-2-(trifluoromethyl)anilino]methyl]piperidin-1-yl]ethanol (PubChem CID 133281371) has the molecular formula C15H20F3N3O3 and a molecular weight of 347.34 g/mol. Its IUPAC name is 2-[4-[[4-nitro-2-(trifluoromethyl)anilino]methyl]piperidin-1-yl]ethanol.
| Compound Name | 2-[4-[[4-nitro-2-(trifluoromethyl)anilino]methyl]piperidin-1-yl]ethanol |
|---|---|
| PubChem CID | 133281371 |
| Molecular Formula | C15H20F3N3O3 |
| Molecular Weight | 347.34 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | 2-[4-[[4-nitro-2-(trifluoromethyl)anilino]methyl]piperidin-1-yl]ethanol |
| SMILES | O=[N+]([O-])c1ccc(NCC2CCN(CCO)CC2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H20F3N3O3/c16-15(17,18)13-9-12(21(23)24)1-2-14(13)19-10-11-3-5-20(6-4-11)7-8-22/h1-2,9,11,19,22H,3-8,10H2 |
| InChIKey | UIQKIPURDWDNEQ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 78.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.34 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|