C14H17F3N2O3 — CID 97255588
N-[[(2S,4R)-2-methyloxan-4-yl]methyl]-4-nitro-2-(trifluoromethyl)aniline (PubChem CID 97255588) has the molecular formula C14H17F3N2O3 and a molecular weight of 318.29 g/mol. Its IUPAC name is N-[[(2S,4R)-2-methyloxan-4-yl]methyl]-4-nitro-2-(trifluoromethyl)aniline.
| Compound Name | N-[[(2S,4R)-2-methyloxan-4-yl]methyl]-4-nitro-2-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 97255588 |
| Molecular Formula | C14H17F3N2O3 |
| Molecular Weight | 318.29 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | N-[[(2S,4R)-2-methyloxan-4-yl]methyl]-4-nitro-2-(trifluoromethyl)aniline |
| SMILES | C[C@H]1C[C@H](CNc2ccc([N+](=O)[O-])cc2C(F)(F)F)CCO1 |
| InChI | InChI=1S/C14H17F3N2O3/c1-9-6-10(4-5-22-9)8-18-13-3-2-11(19(20)21)7-12(13)14(15,16)17/h2-3,7,9-10,18H,4-6,8H2,1H3/t9-,10+/m0/s1 |
| InChIKey | BKZCACHWVNADIW-VHSXEESVSA-N |
| XLogP | 3.84 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.29 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|