About N-(6,7-dinitro-3-oxo-4H-quinoxalin-2-yl)methanesulfonamide
N-(6,7-dinitro-3-oxo-4H-quinoxalin-2-yl)methanesulfonamide (PubChem CID 54119002) has the molecular formula C9H7N5O7S
and a molecular weight of 329.25 g/mol. Its IUPAC name is N-(6,7-dinitro-3-oxo-4H-quinoxalin-2-yl)methanesulfonamide.
Molecular Properties
| Compound Name | N-(6,7-dinitro-3-oxo-4H-quinoxalin-2-yl)methanesulfonamide |
| PubChem CID | 54119002 |
| Molecular Formula | C9H7N5O7S |
| Molecular Weight | 329.25 g/mol |
| Exact Mass | 329.01 |
| IUPAC Name | N-(6,7-dinitro-3-oxo-4H-quinoxalin-2-yl)methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1nc2cc([N+](=O)[O-])c([N+](=O)[O-])cc2[nH]c1=O |
| InChI | InChI=1S/C9H7N5O7S/c1-22(20,21)12-8-9(15)11-5-3-7(14(18)19)6(13(16)17)2-4(5)10-8/h2-3H,1H3,(H,10,12)(H,11,15) |
| InChIKey | NMIBMQOKNOFGGN-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 178.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.25 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(6,7-dinitro-3-oxo-4H-quinoxalin-2-yl)methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(6,7-dinitro-3-oxo-4H-quinoxalin-2-yl)methanesulfonamide?
The IUPAC name of N-(6,7-dinitro-3-oxo-4H-quinoxalin-2-yl)methanesulfonamide (CID 54119002) is N-(6,7-dinitro-3-oxo-4H-quinoxalin-2-yl)methanesulfonamide.
What is the SMILES notation for N-(6,7-dinitro-3-oxo-4H-quinoxalin-2-yl)methanesulfonamide?
The canonical SMILES for N-(6,7-dinitro-3-oxo-4H-quinoxalin-2-yl)methanesulfonamide is CS(=O)(=O)Nc1nc2cc([N+](=O)[O-])c([N+](=O)[O-])cc2[nH]c1=O.
What is the InChIKey of N-(6,7-dinitro-3-oxo-4H-quinoxalin-2-yl)methanesulfonamide?
The InChIKey is NMIBMQOKNOFGGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N5O7S/c1-22(20,21)12-8-9(15)11-5-3-7(14(18)19)6(13(16)17)2-4(5)10-8/h2-3H,1H3,(H,10,12)(H,11,15).
What are the key properties of N-(6,7-dinitro-3-oxo-4H-quinoxalin-2-yl)methanesulfonamide?
N-(6,7-dinitro-3-oxo-4H-quinoxalin-2-yl)methanesulfonamide has a molecular weight of 329.25 g/mol, XLogP of 0.11, 4 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for N-(6,7-dinitro-3-oxo-4H-quinoxalin-2-yl)methanesulfonamide is sourced from PubChem (CID 54119002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).