C9H12N2O4S — CID 60640719
N-(4,5-dimethyl-2-nitrophenyl)methanesulfonamide (PubChem CID 60640719) has the molecular formula C9H12N2O4S and a molecular weight of 244.27 g/mol. Its IUPAC name is N-(4,5-dimethyl-2-nitrophenyl)methanesulfonamide.
| Compound Name | N-(4,5-dimethyl-2-nitrophenyl)methanesulfonamide |
|---|---|
| PubChem CID | 60640719 |
| Molecular Formula | C9H12N2O4S |
| Molecular Weight | 244.27 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | N-(4,5-dimethyl-2-nitrophenyl)methanesulfonamide |
| SMILES | Cc1cc(NS(C)(=O)=O)c([N+](=O)[O-])cc1C |
| InChI | InChI=1S/C9H12N2O4S/c1-6-4-8(10-16(3,14)15)9(11(12)13)5-7(6)2/h4-5,10H,1-3H3 |
| InChIKey | QZDOYTFOBNVWKF-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.27 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|