C7H8ClN3O4S — CID 104668379
1-chloro-4-methyl-2-nitro-5-(sulfamoylamino)benzene (PubChem CID 104668379) has the molecular formula C7H8ClN3O4S and a molecular weight of 265.68 g/mol. Its IUPAC name is 1-chloro-4-methyl-2-nitro-5-(sulfamoylamino)benzene.
| Compound Name | 1-chloro-4-methyl-2-nitro-5-(sulfamoylamino)benzene |
|---|---|
| PubChem CID | 104668379 |
| Molecular Formula | C7H8ClN3O4S |
| Molecular Weight | 265.68 g/mol |
| Exact Mass | 264.99 |
| IUPAC Name | 1-chloro-4-methyl-2-nitro-5-(sulfamoylamino)benzene |
| SMILES | Cc1cc([N+](=O)[O-])c(Cl)cc1NS(N)(=O)=O |
| InChI | InChI=1S/C7H8ClN3O4S/c1-4-2-7(11(12)13)5(8)3-6(4)10-16(9,14)15/h2-3,10H,1H3,(H2,9,14,15) |
| InChIKey | FWVNHWQIOMIETO-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 115.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.68 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|