C11H15ClN2O5 — CID 107849353
2-(5-chloro-2-methyl-4-nitroanilino)-2-(hydroxymethyl)propane-1,3-diol (PubChem CID 107849353) has the molecular formula C11H15ClN2O5 and a molecular weight of 290.70 g/mol. Its IUPAC name is 2-(5-chloro-2-methyl-4-nitroanilino)-2-(hydroxymethyl)propane-1,3-diol.
| Compound Name | 2-(5-chloro-2-methyl-4-nitroanilino)-2-(hydroxymethyl)propane-1,3-diol |
|---|---|
| PubChem CID | 107849353 |
| Molecular Formula | C11H15ClN2O5 |
| Molecular Weight | 290.70 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | 2-(5-chloro-2-methyl-4-nitroanilino)-2-(hydroxymethyl)propane-1,3-diol |
| SMILES | Cc1cc([N+](=O)[O-])c(Cl)cc1NC(CO)(CO)CO |
| InChI | InChI=1S/C11H15ClN2O5/c1-7-2-10(14(18)19)8(12)3-9(7)13-11(4-15,5-16)6-17/h2-3,13,15-17H,4-6H2,1H3 |
| InChIKey | DOBODBDPPBNTPD-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 115.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.70 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|