C11H12N5O5+ — CID 4123455
4-(5,6-dinitro-1H-benzimidazol-2-yl)morpholin-4-ium (PubChem CID 4123455) has the molecular formula C11H12N5O5+ and a molecular weight of 294.25 g/mol. Its IUPAC name is 4-(5,6-dinitro-1H-benzimidazol-2-yl)morpholin-4-ium.
| Compound Name | 4-(5,6-dinitro-1H-benzimidazol-2-yl)morpholin-4-ium |
|---|---|
| PubChem CID | 4123455 |
| Molecular Formula | C11H12N5O5+ |
| Molecular Weight | 294.25 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | 4-(5,6-dinitro-1H-benzimidazol-2-yl)morpholin-4-ium |
| SMILES | O=[N+]([O-])c1cc2nc([NH+]3CCOCC3)[nH]c2cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H11N5O5/c17-15(18)9-5-7-8(6-10(9)16(19)20)13-11(12-7)14-1-3-21-4-2-14/h5-6H,1-4H2,(H,12,13)/p+1 |
| InChIKey | FPMFXAVGFDYILL-UHFFFAOYSA-O |
| XLogP | -0.07 |
| TPSA | 128.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.25 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|