C9H6HgN2O9 — CID 146037530
acetyloxy-(2-carboxy-3-hydroxy-4,6-dinitrophenyl)mercury (PubChem CID 146037530) has the molecular formula C9H6HgN2O9 and a molecular weight of 486.74 g/mol. Its IUPAC name is acetyloxy-(2-carboxy-3-hydroxy-4,6-dinitrophenyl)mercury.
| Compound Name | acetyloxy-(2-carboxy-3-hydroxy-4,6-dinitrophenyl)mercury |
|---|---|
| PubChem CID | 146037530 |
| Molecular Formula | C9H6HgN2O9 |
| Molecular Weight | 486.74 g/mol |
| Exact Mass | 487.98 |
| IUPAC Name | acetyloxy-(2-carboxy-3-hydroxy-4,6-dinitrophenyl)mercury |
| SMILES | CC(=O)O[Hg]c1c([N+](=O)[O-])cc([N+](=O)[O-])c(O)c1C(=O)O |
| InChI | InChI=1S/C7H3N2O7.C2H4O2.Hg/c10-6-4(7(11)12)1-3(8(13)14)2-5(6)9(15)16;1-2(3)4;/h2,10H,(H,11,12);1H3,(H,3,4);/q;;+1/p-1 |
| InChIKey | XPBBRQPJRCSBFI-UHFFFAOYSA-M |
| XLogP | 0.09 |
| TPSA | 170.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.74 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|