C16H20N2O2 — CID 169385232
4-methoxy-3,5-dimethyl-2-[(2-phenylhydrazinyl)methyl]phenol (PubChem CID 169385232) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is 4-methoxy-3,5-dimethyl-2-[(2-phenylhydrazinyl)methyl]phenol.
| Compound Name | 4-methoxy-3,5-dimethyl-2-[(2-phenylhydrazinyl)methyl]phenol |
|---|---|
| PubChem CID | 169385232 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | 4-methoxy-3,5-dimethyl-2-[(2-phenylhydrazinyl)methyl]phenol |
| SMILES | COc1c(C)cc(O)c(CNNc2ccccc2)c1C |
| InChI | InChI=1S/C16H20N2O2/c1-11-9-15(19)14(12(2)16(11)20-3)10-17-18-13-7-5-4-6-8-13/h4-9,17-19H,10H2,1-3H3 |
| InChIKey | WICYACGZGOGKAQ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|