C13H11Br3N2O — CID 169384554
2,4,6-tribromo-3-[(2-phenylhydrazinyl)methyl]phenol (PubChem CID 169384554) has the molecular formula C13H11Br3N2O and a molecular weight of 450.96 g/mol. Its IUPAC name is 2,4,6-tribromo-3-[(2-phenylhydrazinyl)methyl]phenol.
| Compound Name | 2,4,6-tribromo-3-[(2-phenylhydrazinyl)methyl]phenol |
|---|---|
| PubChem CID | 169384554 |
| Molecular Formula | C13H11Br3N2O |
| Molecular Weight | 450.96 g/mol |
| Exact Mass | 447.84 |
| IUPAC Name | 2,4,6-tribromo-3-[(2-phenylhydrazinyl)methyl]phenol |
| SMILES | Oc1c(Br)cc(Br)c(CNNc2ccccc2)c1Br |
| InChI | InChI=1S/C13H11Br3N2O/c14-10-6-11(15)13(19)12(16)9(10)7-17-18-8-4-2-1-3-5-8/h1-6,17-19H,7H2 |
| InChIKey | FHGRGXQCZOYESQ-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.96 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|