C15H14Cl2N2O2 — CID 169387072
[3,5-dichloro-4-[(2-phenylhydrazinyl)methyl]phenyl] acetate (PubChem CID 169387072) has the molecular formula C15H14Cl2N2O2 and a molecular weight of 325.20 g/mol. Its IUPAC name is [3,5-dichloro-4-[(2-phenylhydrazinyl)methyl]phenyl] acetate.
| Compound Name | [3,5-dichloro-4-[(2-phenylhydrazinyl)methyl]phenyl] acetate |
|---|---|
| PubChem CID | 169387072 |
| Molecular Formula | C15H14Cl2N2O2 |
| Molecular Weight | 325.20 g/mol |
| Exact Mass | 324.04 |
| IUPAC Name | [3,5-dichloro-4-[(2-phenylhydrazinyl)methyl]phenyl] acetate |
| SMILES | CC(=O)Oc1cc(Cl)c(CNNc2ccccc2)c(Cl)c1 |
| InChI | InChI=1S/C15H14Cl2N2O2/c1-10(20)21-12-7-14(16)13(15(17)8-12)9-18-19-11-5-3-2-4-6-11/h2-8,18-19H,9H2,1H3 |
| InChIKey | MFXRPDBKSYGESE-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.20 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|