C19H16Cl2N2O — CID 169386901
1-[[3-(3,4-dichlorophenoxy)phenyl]methyl]-2-phenylhydrazine (PubChem CID 169386901) has the molecular formula C19H16Cl2N2O and a molecular weight of 359.26 g/mol. Its IUPAC name is 1-[[3-(3,4-dichlorophenoxy)phenyl]methyl]-2-phenylhydrazine.
| Compound Name | 1-[[3-(3,4-dichlorophenoxy)phenyl]methyl]-2-phenylhydrazine |
|---|---|
| PubChem CID | 169386901 |
| Molecular Formula | C19H16Cl2N2O |
| Molecular Weight | 359.26 g/mol |
| Exact Mass | 358.06 |
| IUPAC Name | 1-[[3-(3,4-dichlorophenoxy)phenyl]methyl]-2-phenylhydrazine |
| SMILES | Clc1ccc(Oc2cccc(CNNc3ccccc3)c2)cc1Cl |
| InChI | InChI=1S/C19H16Cl2N2O/c20-18-10-9-17(12-19(18)21)24-16-8-4-5-14(11-16)13-22-23-15-6-2-1-3-7-15/h1-12,22-23H,13H2 |
| InChIKey | UAZLYWYNGDMAQR-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.26 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|