C19H16Cl2N2 — CID 169386868
1-[[4-(3,4-dichlorophenyl)phenyl]methyl]-2-phenylhydrazine (PubChem CID 169386868) has the molecular formula C19H16Cl2N2 and a molecular weight of 343.26 g/mol. Its IUPAC name is 1-[[4-(3,4-dichlorophenyl)phenyl]methyl]-2-phenylhydrazine.
| Compound Name | 1-[[4-(3,4-dichlorophenyl)phenyl]methyl]-2-phenylhydrazine |
|---|---|
| PubChem CID | 169386868 |
| Molecular Formula | C19H16Cl2N2 |
| Molecular Weight | 343.26 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | 1-[[4-(3,4-dichlorophenyl)phenyl]methyl]-2-phenylhydrazine |
| SMILES | Clc1ccc(-c2ccc(CNNc3ccccc3)cc2)cc1Cl |
| InChI | InChI=1S/C19H16Cl2N2/c20-18-11-10-16(12-19(18)21)15-8-6-14(7-9-15)13-22-23-17-4-2-1-3-5-17/h1-12,22-23H,13H2 |
| InChIKey | BFXFWRPHKSFZAE-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.26 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|