C22H22N2O2 — CID 169386819
1-[[4-[4-(1,3-dioxolan-2-yl)phenyl]phenyl]methyl]-2-phenylhydrazine (PubChem CID 169386819) has the molecular formula C22H22N2O2 and a molecular weight of 346.43 g/mol. Its IUPAC name is 1-[[4-[4-(1,3-dioxolan-2-yl)phenyl]phenyl]methyl]-2-phenylhydrazine.
| Compound Name | 1-[[4-[4-(1,3-dioxolan-2-yl)phenyl]phenyl]methyl]-2-phenylhydrazine |
|---|---|
| PubChem CID | 169386819 |
| Molecular Formula | C22H22N2O2 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | 1-[[4-[4-(1,3-dioxolan-2-yl)phenyl]phenyl]methyl]-2-phenylhydrazine |
| SMILES | c1ccc(NNCc2ccc(-c3ccc(C4OCCO4)cc3)cc2)cc1 |
| InChI | InChI=1S/C22H22N2O2/c1-2-4-21(5-3-1)24-23-16-17-6-8-18(9-7-17)19-10-12-20(13-11-19)22-25-14-15-26-22/h1-13,22-24H,14-16H2 |
| InChIKey | IQRJTSRSCANACM-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|