About 1-[[4-[4-(1,3-dioxolan-2-yl)phenyl]phenyl]methyl]-2-phenylhydrazine
1-[[4-[4-(1,3-dioxolan-2-yl)phenyl]phenyl]methyl]-2-phenylhydrazine (PubChem CID 169386819) has the molecular formula C22H22N2O2
and a molecular weight of 346.43 g/mol. Its IUPAC name is 1-[[4-[4-(1,3-dioxolan-2-yl)phenyl]phenyl]methyl]-2-phenylhydrazine.
Molecular Properties
| Compound Name | 1-[[4-[4-(1,3-dioxolan-2-yl)phenyl]phenyl]methyl]-2-phenylhydrazine |
| PubChem CID | 169386819 |
| Molecular Formula | C22H22N2O2 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | 1-[[4-[4-(1,3-dioxolan-2-yl)phenyl]phenyl]methyl]-2-phenylhydrazine |
| SMILES | c1ccc(NNCc2ccc(-c3ccc(C4OCCO4)cc3)cc2)cc1 |
| InChI | InChI=1S/C22H22N2O2/c1-2-4-21(5-3-1)24-23-16-17-6-8-18(9-7-17)19-10-12-20(13-11-19)22-25-14-15-26-22/h1-13,22-24H,14-16H2 |
| InChIKey | IQRJTSRSCANACM-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[[4-[4-(1,3-dioxolan-2-yl)phenyl]phenyl]methyl]-2-phenylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[4-[4-(1,3-dioxolan-2-yl)phenyl]phenyl]methyl]-2-phenylhydrazine?
The IUPAC name of 1-[[4-[4-(1,3-dioxolan-2-yl)phenyl]phenyl]methyl]-2-phenylhydrazine (CID 169386819) is 1-[[4-[4-(1,3-dioxolan-2-yl)phenyl]phenyl]methyl]-2-phenylhydrazine.
What is the SMILES notation for 1-[[4-[4-(1,3-dioxolan-2-yl)phenyl]phenyl]methyl]-2-phenylhydrazine?
The canonical SMILES for 1-[[4-[4-(1,3-dioxolan-2-yl)phenyl]phenyl]methyl]-2-phenylhydrazine is c1ccc(NNCc2ccc(-c3ccc(C4OCCO4)cc3)cc2)cc1.
What is the InChIKey of 1-[[4-[4-(1,3-dioxolan-2-yl)phenyl]phenyl]methyl]-2-phenylhydrazine?
The InChIKey is IQRJTSRSCANACM-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22N2O2/c1-2-4-21(5-3-1)24-23-16-17-6-8-18(9-7-17)19-10-12-20(13-11-19)22-25-14-15-26-22/h1-13,22-24H,14-16H2.
What are the key properties of 1-[[4-[4-(1,3-dioxolan-2-yl)phenyl]phenyl]methyl]-2-phenylhydrazine?
1-[[4-[4-(1,3-dioxolan-2-yl)phenyl]phenyl]methyl]-2-phenylhydrazine has a molecular weight of 346.43 g/mol, XLogP of 4.52, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[4-[4-(1,3-dioxolan-2-yl)phenyl]phenyl]methyl]-2-phenylhydrazine is sourced from PubChem (CID 169386819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).