C13H11BrF2N2 — CID 169384645
1-[(2-bromo-3,5-difluorophenyl)methyl]-2-phenylhydrazine (PubChem CID 169384645) has the molecular formula C13H11BrF2N2 and a molecular weight of 313.15 g/mol. Its IUPAC name is 1-[(2-bromo-3,5-difluorophenyl)methyl]-2-phenylhydrazine.
| Compound Name | 1-[(2-bromo-3,5-difluorophenyl)methyl]-2-phenylhydrazine |
|---|---|
| PubChem CID | 169384645 |
| Molecular Formula | C13H11BrF2N2 |
| Molecular Weight | 313.15 g/mol |
| Exact Mass | 312.01 |
| IUPAC Name | 1-[(2-bromo-3,5-difluorophenyl)methyl]-2-phenylhydrazine |
| SMILES | Fc1cc(F)c(Br)c(CNNc2ccccc2)c1 |
| InChI | InChI=1S/C13H11BrF2N2/c14-13-9(6-10(15)7-12(13)16)8-17-18-11-4-2-1-3-5-11/h1-7,17-18H,8H2 |
| InChIKey | LNWDRWSPYQQEDC-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.15 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|