C16H18Br2N2O2 — CID 169386351
1-[(2,3-dibromo-4-ethoxy-5-methoxyphenyl)methyl]-2-phenylhydrazine (PubChem CID 169386351) has the molecular formula C16H18Br2N2O2 and a molecular weight of 430.14 g/mol. Its IUPAC name is 1-[(2,3-dibromo-4-ethoxy-5-methoxyphenyl)methyl]-2-phenylhydrazine.
| Compound Name | 1-[(2,3-dibromo-4-ethoxy-5-methoxyphenyl)methyl]-2-phenylhydrazine |
|---|---|
| PubChem CID | 169386351 |
| Molecular Formula | C16H18Br2N2O2 |
| Molecular Weight | 430.14 g/mol |
| Exact Mass | 427.97 |
| IUPAC Name | 1-[(2,3-dibromo-4-ethoxy-5-methoxyphenyl)methyl]-2-phenylhydrazine |
| SMILES | CCOc1c(OC)cc(CNNc2ccccc2)c(Br)c1Br |
| InChI | InChI=1S/C16H18Br2N2O2/c1-3-22-16-13(21-2)9-11(14(17)15(16)18)10-19-20-12-7-5-4-6-8-12/h4-9,19-20H,3,10H2,1-2H3 |
| InChIKey | TYFHCXVSGKRXEV-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.14 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|