C20H25BrN2O2 — CID 169386277
1-[(2-bromo-4-cyclopentyloxy-5-ethoxyphenyl)methyl]-2-phenylhydrazine (PubChem CID 169386277) has the molecular formula C20H25BrN2O2 and a molecular weight of 405.34 g/mol. Its IUPAC name is 1-[(2-bromo-4-cyclopentyloxy-5-ethoxyphenyl)methyl]-2-phenylhydrazine.
| Compound Name | 1-[(2-bromo-4-cyclopentyloxy-5-ethoxyphenyl)methyl]-2-phenylhydrazine |
|---|---|
| PubChem CID | 169386277 |
| Molecular Formula | C20H25BrN2O2 |
| Molecular Weight | 405.34 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | 1-[(2-bromo-4-cyclopentyloxy-5-ethoxyphenyl)methyl]-2-phenylhydrazine |
| SMILES | CCOc1cc(CNNc2ccccc2)c(Br)cc1OC1CCCC1 |
| InChI | InChI=1S/C20H25BrN2O2/c1-2-24-19-12-15(14-22-23-16-8-4-3-5-9-16)18(21)13-20(19)25-17-10-6-7-11-17/h3-5,8-9,12-13,17,22-23H,2,6-7,10-11,14H2,1H3 |
| InChIKey | QDXIRCDOKLBFIT-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.34 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|