C20H25BrN2O4 — CID 169386474
propan-2-yl 2-[5-bromo-2-ethoxy-4-[(2-phenylhydrazinyl)methyl]phenoxy]acetate (PubChem CID 169386474) has the molecular formula C20H25BrN2O4 and a molecular weight of 437.33 g/mol. Its IUPAC name is propan-2-yl 2-[5-bromo-2-ethoxy-4-[(2-phenylhydrazinyl)methyl]phenoxy]acetate.
| Compound Name | propan-2-yl 2-[5-bromo-2-ethoxy-4-[(2-phenylhydrazinyl)methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 169386474 |
| Molecular Formula | C20H25BrN2O4 |
| Molecular Weight | 437.33 g/mol |
| Exact Mass | 436.10 |
| IUPAC Name | propan-2-yl 2-[5-bromo-2-ethoxy-4-[(2-phenylhydrazinyl)methyl]phenoxy]acetate |
| SMILES | CCOc1cc(CNNc2ccccc2)c(Br)cc1OCC(=O)OC(C)C |
| InChI | InChI=1S/C20H25BrN2O4/c1-4-25-18-10-15(12-22-23-16-8-6-5-7-9-16)17(21)11-19(18)26-13-20(24)27-14(2)3/h5-11,14,22-23H,4,12-13H2,1-3H3 |
| InChIKey | MYBOIEFELASKMZ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.33 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|