C18H29BrClNO3 — CID 2990057
2-[(2-bromo-4-cyclopentyloxy-5-ethoxyphenyl)methylamino]butan-1-ol;hydrochloride (PubChem CID 2990057) has the molecular formula C18H29BrClNO3 and a molecular weight of 422.79 g/mol. Its IUPAC name is 2-[(2-bromo-4-cyclopentyloxy-5-ethoxyphenyl)methylamino]butan-1-ol;hydrochloride.
| Compound Name | 2-[(2-bromo-4-cyclopentyloxy-5-ethoxyphenyl)methylamino]butan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 2990057 |
| Molecular Formula | C18H29BrClNO3 |
| Molecular Weight | 422.79 g/mol |
| Exact Mass | 421.10 |
| IUPAC Name | 2-[(2-bromo-4-cyclopentyloxy-5-ethoxyphenyl)methylamino]butan-1-ol;hydrochloride |
| SMILES | CCOc1cc(CNC(CC)CO)c(Br)cc1OC1CCCC1.Cl |
| InChI | InChI=1S/C18H28BrNO3.ClH/c1-3-14(12-21)20-11-13-9-17(22-4-2)18(10-16(13)19)23-15-7-5-6-8-15;/h9-10,14-15,20-21H,3-8,11-12H2,1-2H3;1H |
| InChIKey | QMEJQTCZSSGUOG-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.79 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |