C17H18Br2N2O2 — CID 169386352
1-[(2,3-dibromo-5-methoxy-4-prop-2-enoxyphenyl)methyl]-2-phenylhydrazine (PubChem CID 169386352) has the molecular formula C17H18Br2N2O2 and a molecular weight of 442.15 g/mol. Its IUPAC name is 1-[(2,3-dibromo-5-methoxy-4-prop-2-enoxyphenyl)methyl]-2-phenylhydrazine.
| Compound Name | 1-[(2,3-dibromo-5-methoxy-4-prop-2-enoxyphenyl)methyl]-2-phenylhydrazine |
|---|---|
| PubChem CID | 169386352 |
| Molecular Formula | C17H18Br2N2O2 |
| Molecular Weight | 442.15 g/mol |
| Exact Mass | 439.97 |
| IUPAC Name | 1-[(2,3-dibromo-5-methoxy-4-prop-2-enoxyphenyl)methyl]-2-phenylhydrazine |
| SMILES | C=CCOc1c(OC)cc(CNNc2ccccc2)c(Br)c1Br |
| InChI | InChI=1S/C17H18Br2N2O2/c1-3-9-23-17-14(22-2)10-12(15(18)16(17)19)11-20-21-13-7-5-4-6-8-13/h3-8,10,20-21H,1,9,11H2,2H3 |
| InChIKey | VUYZWNAXPOACCN-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.15 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|