C13H12Br2N2 — CID 169384469
1-[(2,6-dibromophenyl)methyl]-2-phenylhydrazine (PubChem CID 169384469) has the molecular formula C13H12Br2N2 and a molecular weight of 356.06 g/mol. Its IUPAC name is 1-[(2,6-dibromophenyl)methyl]-2-phenylhydrazine.
| Compound Name | 1-[(2,6-dibromophenyl)methyl]-2-phenylhydrazine |
|---|---|
| PubChem CID | 169384469 |
| Molecular Formula | C13H12Br2N2 |
| Molecular Weight | 356.06 g/mol |
| Exact Mass | 353.94 |
| IUPAC Name | 1-[(2,6-dibromophenyl)methyl]-2-phenylhydrazine |
| SMILES | Brc1cccc(Br)c1CNNc1ccccc1 |
| InChI | InChI=1S/C13H12Br2N2/c14-12-7-4-8-13(15)11(12)9-16-17-10-5-2-1-3-6-10/h1-8,16-17H,9H2 |
| InChIKey | WILTYOSDFIXWPI-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.06 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|