C9H12ClNO — CID 117280314
N-[(6-chloro-2,3-dimethylphenyl)methyl]hydroxylamine (PubChem CID 117280314) has the molecular formula C9H12ClNO and a molecular weight of 185.65 g/mol. Its IUPAC name is N-[(6-chloro-2,3-dimethylphenyl)methyl]hydroxylamine.
| Compound Name | N-[(6-chloro-2,3-dimethylphenyl)methyl]hydroxylamine |
|---|---|
| PubChem CID | 117280314 |
| Molecular Formula | C9H12ClNO |
| Molecular Weight | 185.65 g/mol |
| Exact Mass | 185.06 |
| IUPAC Name | N-[(6-chloro-2,3-dimethylphenyl)methyl]hydroxylamine |
| SMILES | Cc1ccc(Cl)c(CNO)c1C |
| InChI | InChI=1S/C9H12ClNO/c1-6-3-4-9(10)8(5-11-12)7(6)2/h3-4,11-12H,5H2,1-2H3 |
| InChIKey | HJBVKRWXRTVWBZ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.65 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|