C10H14ClN — CID 84659371
1-(6-chloro-2,3-dimethylphenyl)-N-methylmethanamine (PubChem CID 84659371) has the molecular formula C10H14ClN and a molecular weight of 183.68 g/mol. Its IUPAC name is 1-(6-chloro-2,3-dimethylphenyl)-N-methylmethanamine.
| Compound Name | 1-(6-chloro-2,3-dimethylphenyl)-N-methylmethanamine |
|---|---|
| PubChem CID | 84659371 |
| Molecular Formula | C10H14ClN |
| Molecular Weight | 183.68 g/mol |
| Exact Mass | 183.08 |
| IUPAC Name | 1-(6-chloro-2,3-dimethylphenyl)-N-methylmethanamine |
| SMILES | CNCc1c(Cl)ccc(C)c1C |
| InChI | InChI=1S/C10H14ClN/c1-7-4-5-10(11)9(6-12-3)8(7)2/h4-5,12H,6H2,1-3H3 |
| InChIKey | LIAMSHHKXFCGHS-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.68 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |