C21H31N2OP — CID 141043283
2,6-ditert-butyl-4-[(pyridin-3-ylmethylamino)methylphosphanyl]phenol (PubChem CID 141043283) has the molecular formula C21H31N2OP and a molecular weight of 358.47 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[(pyridin-3-ylmethylamino)methylphosphanyl]phenol.
| Compound Name | 2,6-ditert-butyl-4-[(pyridin-3-ylmethylamino)methylphosphanyl]phenol |
|---|---|
| PubChem CID | 141043283 |
| Molecular Formula | C21H31N2OP |
| Molecular Weight | 358.47 g/mol |
| Exact Mass | 358.22 |
| IUPAC Name | 2,6-ditert-butyl-4-[(pyridin-3-ylmethylamino)methylphosphanyl]phenol |
| SMILES | CC(C)(C)c1cc(PCNCc2cccnc2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C21H31N2OP/c1-20(2,3)17-10-16(11-18(19(17)24)21(4,5)6)25-14-23-13-15-8-7-9-22-12-15/h7-12,23-25H,13-14H2,1-6H3 |
| InChIKey | DOJIWWSPKFPXKT-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.47 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|