C22H32N2O — CID 10315227
3,5-ditert-butyl-2-[(2-pyridin-3-ylethylamino)methyl]phenol (PubChem CID 10315227) has the molecular formula C22H32N2O and a molecular weight of 340.51 g/mol. Its IUPAC name is 3,5-ditert-butyl-2-[(2-pyridin-3-ylethylamino)methyl]phenol.
| Compound Name | 3,5-ditert-butyl-2-[(2-pyridin-3-ylethylamino)methyl]phenol |
|---|---|
| PubChem CID | 10315227 |
| Molecular Formula | C22H32N2O |
| Molecular Weight | 340.51 g/mol |
| Exact Mass | 340.25 |
| IUPAC Name | 3,5-ditert-butyl-2-[(2-pyridin-3-ylethylamino)methyl]phenol |
| SMILES | CC(C)(C)c1cc(O)c(CNCCc2cccnc2)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C22H32N2O/c1-21(2,3)17-12-19(22(4,5)6)18(20(25)13-17)15-24-11-9-16-8-7-10-23-14-16/h7-8,10,12-14,24-25H,9,11,15H2,1-6H3 |
| InChIKey | NHYNMAMQCCXJME-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.51 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|