C11F15N3 — CID 151989480
1-azido-2,3,4,5,6-pentakis(trifluoromethyl)benzene (PubChem CID 151989480) has the molecular formula C11F15N3 and a molecular weight of 459.11 g/mol. Its IUPAC name is 1-azido-2,3,4,5,6-pentakis(trifluoromethyl)benzene.
| Compound Name | 1-azido-2,3,4,5,6-pentakis(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 151989480 |
| Molecular Formula | C11F15N3 |
| Molecular Weight | 459.11 g/mol |
| Exact Mass | 458.99 |
| IUPAC Name | 1-azido-2,3,4,5,6-pentakis(trifluoromethyl)benzene |
| SMILES | [N-]=[N+]=Nc1c(C(F)(F)F)c(C(F)(F)F)c(C(F)(F)F)c(C(F)(F)F)c1C(F)(F)F |
| InChI | InChI=1S/C11F15N3/c12-7(13,14)1-2(8(15,16)17)4(10(21,22)23)6(28-29-27)5(11(24,25)26)3(1)9(18,19)20 |
| InChIKey | UEJFMIBVAXPQBF-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.11 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|