C10F7N3 — CID 91069544
1-azido-2,3,4,5,6,7,8-heptafluoronaphthalene (PubChem CID 91069544) has the molecular formula C10F7N3 and a molecular weight of 295.12 g/mol. Its IUPAC name is 1-azido-2,3,4,5,6,7,8-heptafluoronaphthalene.
| Compound Name | 1-azido-2,3,4,5,6,7,8-heptafluoronaphthalene |
|---|---|
| PubChem CID | 91069544 |
| Molecular Formula | C10F7N3 |
| Molecular Weight | 295.12 g/mol |
| Exact Mass | 295.00 |
| IUPAC Name | 1-azido-2,3,4,5,6,7,8-heptafluoronaphthalene |
| SMILES | [N-]=[N+]=Nc1c(F)c(F)c(F)c2c(F)c(F)c(F)c(F)c12 |
| InChI | InChI=1S/C10F7N3/c11-3-1-2(5(13)7(15)6(3)14)10(19-20-18)9(17)8(16)4(1)12 |
| InChIKey | VCSFIMGRNBFCKD-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.12 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|