C27H11F12N9O7 — CID 170651353
[2,2-bis[(4-azido-2,3,5,6-tetrafluorobenzoyl)oxymethyl]-3-methoxypropyl] 4-azido-2,3,5,6-tetrafluorobenzoate (PubChem CID 170651353) has the molecular formula C27H11F12N9O7 and a molecular weight of 801.42 g/mol. Its IUPAC name is [2,2-bis[(4-azido-2,3,5,6-tetrafluorobenzoyl)oxymethyl]-3-methoxypropyl] 4-azido-2,3,5,6-tetrafluorobenzoate.
| Compound Name | [2,2-bis[(4-azido-2,3,5,6-tetrafluorobenzoyl)oxymethyl]-3-methoxypropyl] 4-azido-2,3,5,6-tetrafluorobenzoate |
|---|---|
| PubChem CID | 170651353 |
| Molecular Formula | C27H11F12N9O7 |
| Molecular Weight | 801.42 g/mol |
| Exact Mass | 801.06 |
| IUPAC Name | [2,2-bis[(4-azido-2,3,5,6-tetrafluorobenzoyl)oxymethyl]-3-methoxypropyl] 4-azido-2,3,5,6-tetrafluorobenzoate |
| SMILES | COCC(COC(=O)c1c(F)c(F)c(N=[N+]=[N-])c(F)c1F)(COC(=O)c1c(F)c(F)c(N=[N+]=[N-])c(F)c1F)COC(=O)c1c(F)c(F)c(N=[N+]=[N-])c(F)c1F |
| InChI | InChI=1S/C27H11F12N9O7/c1-52-2-27(3-53-24(49)6-9(28)15(34)21(43-46-40)16(35)10(6)29,4-54-25(50)7-11(30)17(36)22(44-47-41)18(37)12(7)31)5-55-26(51)8-13(32)19(38)23(45-48-42)20(39)14(8)33/h2-5H2,1H3 |
| InChIKey | LVZUQSTVDYXNCT-UHFFFAOYSA-N |
| XLogP | 8.68 |
| TPSA | 234.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 801.42 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|